CAS 6646-46-4 appears in our catalog under these names: 6-(4-Bromophenyl)-2,3,5,6-tetrahydroimidazo(2,1-b)thiazole, 97%, 6-(4-Bromophenyl)-2H,3H,5H,6H-imidazo(2,1-b)(1,3)thiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
6-(4-bromophenyl)-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (CAS 6646-46-4) is a chemical compound with the molecular formula C11H11BrN2S and a molecular weight of 283.19 g/mol. IUPAC name: 6-(4-bromophenyl)-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole. InChIKey: HTHGAIADRJRJOY-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2S |
|---|---|
| Molecular weight | 283.19 g/mol |
| IUPAC name | 6-(4-bromophenyl)-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
| InChIKey | HTHGAIADRJRJOY-UHFFFAOYSA-N |
| SMILES | C1CSC2=NC(CN21)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)