CAS 1415564-69-0 appears in our catalog under these names: 4-(4-Bromothiazol-2-yl)-N,N-dimethylaniline, 98%, 4-(4-Bromothiazol-2-yl)-N,N-dimethylaniline, 97%, 97%, 4-(4-Bromothiazol-2-yl)-N,N-dimethylaniline, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg.
4-(4-bromo-1,3-thiazol-2-yl)-N,N-dimethylaniline (CAS 1415564-69-0) is a chemical compound with the molecular formula C11H11BrN2S and a molecular weight of 283.19 g/mol. IUPAC name: 4-(4-bromo-1,3-thiazol-2-yl)-N,N-dimethylaniline. InChIKey: GZKYURYAOIMNNX-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2S |
|---|---|
| Molecular weight | 283.19 g/mol |
| IUPAC name | 4-(4-bromo-1,3-thiazol-2-yl)-N,N-dimethylaniline |
| InChIKey | GZKYURYAOIMNNX-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C2=NC(=CS2)Br |
Computed by PubChem (NCBI)