CAS 642929-49-5 is the registry number for 1-(4-(4-Bromophenyl)-1,3-thiazol-2-yl)ethan-1-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]ethanamine (CAS 642929-49-5) is a chemical compound with the molecular formula C11H11BrN2S and a molecular weight of 283.19 g/mol. IUPAC name: 1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]ethanamine. InChIKey: KUWRUGPKOMAJOU-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2S |
|---|---|
| Molecular weight | 283.19 g/mol |
| IUPAC name | 1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]ethanamine |
| InChIKey | KUWRUGPKOMAJOU-UHFFFAOYSA-N |
| SMILES | CC(C1=NC(=CS1)C2=CC=C(C=C2)Br)N |
Computed by PubChem (NCBI)