CAS 104175-33-9 appears in our catalog under these names: 2,6-Dimethylquinoline-4-carboxylic acid, 95%, 2,6-Dimethylquinoline-4-carboxylic acid, ≥98%, ≥98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 25g, 5g, 1g, 100mg, 250mg.
2,6-dimethylquinoline-4-carboxylic acid (CAS 104175-33-9) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: 2,6-dimethylquinoline-4-carboxylic acid. InChIKey: PPFCNYVQJDEENH-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 2,6-dimethylquinoline-4-carboxylic acid |
| InChIKey | PPFCNYVQJDEENH-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C(N=C2C=C1)C)C(=O)O |
Computed by PubChem (NCBI)