CAS 10419-67-7 appears in our catalog under these names: (R)-2-Benzamido-2-phenylacetic acid, 97%, (R)–2–Benzamido–2–phenylacetic acid, Bz-D-Phg-OH 97%, (R)-2-Benzamido-2-phenylacetic acid, 97%, 97%, (R)-2-Benzamido-2-phenylacetic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg.
(2R)-2-benzamido-2-phenylacetic acid (CAS 10419-67-7) is a chemical compound with the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. IUPAC name: (2R)-2-benzamido-2-phenylacetic acid. InChIKey: ACDLFRQZDTZESK-CYBMUJFWSA-N.
| Molecular formula | C15H13NO3 |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | (2R)-2-benzamido-2-phenylacetic acid |
| InChIKey | ACDLFRQZDTZESK-CYBMUJFWSA-N |
| SMILES | C1=CC=C(C=C1)[C@H](C(=O)O)NC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)