CAS 1042593-15-6 appears in our catalog under these names: N-(4-Hydroxyphenyl)thiophene-3-carboxamide, 95%, N-(4-Hydroxyphenyl)thiophene-3-carboxamide. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 250mg, 2,5g.
N-(4-hydroxyphenyl)thiophene-3-carboxamide (CAS 1042593-15-6) is a chemical compound with the molecular formula C11H9NO2S and a molecular weight of 219.26 g/mol. IUPAC name: N-(4-hydroxyphenyl)thiophene-3-carboxamide. InChIKey: IKAKSUABEFMICS-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2S |
|---|---|
| Molecular weight | 219.26 g/mol |
| IUPAC name | N-(4-hydroxyphenyl)thiophene-3-carboxamide |
| InChIKey | IKAKSUABEFMICS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)C2=CSC=C2)O |
Computed by PubChem (NCBI)