Products 1042629-06-0
CAS 1042629-06-0 is the registry number for 2-((4-Methylpiperazin-1-yl)sulfonyl)acetic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-methylpiperazin-1-yl)sulfonylacetic acid (CAS 1042629-06-0) is a chemical compound with the molecular formula C7H14N2O4S and a molecular weight of 222.26 g/mol. IUPAC name: 2-(4-methylpiperazin-1-yl)sulfonylacetic acid. InChIKey: LTEMSUYSUQCRGJ-UHFFFAOYSA-N.
| Molecular formula | C7H14N2O4S |
|---|---|
| Molecular weight | 222.26 g/mol |
| IUPAC name | 2-(4-methylpiperazin-1-yl)sulfonylacetic acid |
| InChIKey | LTEMSUYSUQCRGJ-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)S(=O)(=O)CC(=O)O |
Computed by PubChem (NCBI)