Products 1795135-15-7
CAS 1795135-15-7 appears in our catalog under these names: Aldicarb-d3 Sulfone, >95% (HPLC), Aldicarb-sulfone D3. Offered by: TRC, Dr. Ehrenstorfer. Available pack sizes: 10mg, 1mg.
[(E)-(2-methyl-2-methylsulfonylpropylidene)amino] N-(trideuteriomethyl)carbamate (CAS 1795135-15-7) is a chemical compound with the molecular formula C7H14N2O4S and a molecular weight of 225.28 g/mol. IUPAC name: [(E)-(2-methyl-2-methylsulfonylpropylidene)amino] N-(trideuteriomethyl)carbamate. InChIKey: YRRKLBAKDXSTNC-UYUKVFNDSA-N.
| Molecular formula | C7H14N2O4S |
|---|---|
| Molecular weight | 225.28 g/mol |
| IUPAC name | [(E)-(2-methyl-2-methylsulfonylpropylidene)amino] N-(trideuteriomethyl)carbamate |
| InChIKey | YRRKLBAKDXSTNC-UYUKVFNDSA-N |
| SMILES | [2H]C([2H])([2H])NC(=O)O/N=C/C(C)(C)S(=O)(=O)C |
Computed by PubChem (NCBI)