CAS 1261170-76-6 appears in our catalog under these names: Aldicarb-(N-methyl-13C,D3 carbamoyl-13C) Sulfone, ALDICARB-(N-METHYL-13C,D3, CARBAMOYL-1&, 13C2,D3-Aldicarb-sulfone, 13C2,D3-Aldicarb-sulfone, Concentration: 100 µg/ml Solvent: Acetonitrile, Aldicarb sulfone-13C2,d3. Offered by: TRC, Sigma-Aldrich, HPC Standards, MedChemExpress. Available pack sizes: 200mg, 1MG, 1x5mg, 1x1ml, Get quote.
[(E)-(2-methyl-2-methylsulfonylpropylidene)amino] N-(trideuterio(113C)methyl)carbamate (CAS 1261170-76-6) is a chemical compound with the molecular formula C7H14N2O4S and a molecular weight of 227.27 g/mol. IUPAC name: [(E)-(2-methyl-2-methylsulfonylpropylidene)amino] N-(trideuterio(113C)methyl)carbamate. InChIKey: YRRKLBAKDXSTNC-FONWFMSDSA-N.
| Molecular formula | C7H14N2O4S |
|---|---|
| Molecular weight | 227.27 g/mol |
| IUPAC name | [(E)-(2-methyl-2-methylsulfonylpropylidene)amino] N-(trideuterio(113C)methyl)carbamate |
| InChIKey | YRRKLBAKDXSTNC-FONWFMSDSA-N |
| SMILES | [2H][13C]([2H])([2H])N[13C](=O)O/N=C/C(C)(C)S(=O)(=O)C |
Computed by PubChem (NCBI)