CAS 1564266-74-5 is the registry number for Saxagliptin Impurity 28 Mesylate. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,3R,5S)-2-azabicyclo[3.1.0]hexane-3-carboxamide;methanesulfonic acid (CAS 1564266-74-5) is a chemical compound with the molecular formula C7H14N2O4S and a molecular weight of 222.26 g/mol. IUPAC name: (1S,3R,5S)-2-azabicyclo[3.1.0]hexane-3-carboxamide;methanesulfonic acid. InChIKey: WPIYZQBALIBMAA-ASMLCRKRSA-N.
| Molecular formula | C7H14N2O4S |
|---|---|
| Molecular weight | 222.26 g/mol |
| IUPAC name | (1S,3R,5S)-2-azabicyclo[3.1.0]hexane-3-carboxamide;methanesulfonic acid |
| InChIKey | WPIYZQBALIBMAA-ASMLCRKRSA-N |
| SMILES | CS(=O)(=O)O.C1[C@@H]2[C@H]1N[C@H](C2)C(=O)N |
Computed by PubChem (NCBI)