CAS 1342655-63-3 is the registry number for 1-(Dimethylsulfamoyl)pyrrolidine-3-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1-(dimethylsulfamoyl)pyrrolidine-3-carboxylic acid (CAS 1342655-63-3) is a chemical compound with the molecular formula C7H14N2O4S and a molecular weight of 222.26 g/mol. IUPAC name: 1-(dimethylsulfamoyl)pyrrolidine-3-carboxylic acid. InChIKey: YLKGKWRNRPMDAD-UHFFFAOYSA-N.
| Molecular formula | C7H14N2O4S |
|---|---|
| Molecular weight | 222.26 g/mol |
| IUPAC name | 1-(dimethylsulfamoyl)pyrrolidine-3-carboxylic acid |
| InChIKey | YLKGKWRNRPMDAD-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)N1CCC(C1)C(=O)O |
Computed by PubChem (NCBI)