Products 146764-57-0
CAS 146764-57-0 appears in our catalog under these names: D,L-Cystathionine-d4, >95% (HPLC), DL-Cystathionine-d4, 99.20%. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
2,4-diamino-2-(1,1,2,2-tetradeuterio-2-sulfanylethyl)pentanedioic acid (CAS 146764-57-0) is a chemical compound with the molecular formula C7H14N2O4S and a molecular weight of 226.29 g/mol. IUPAC name: 2,4-diamino-2-(1,1,2,2-tetradeuterio-2-sulfanylethyl)pentanedioic acid. InChIKey: MJMYLYUUBMQRFM-LNLMKGTHSA-N.
| Molecular formula | C7H14N2O4S |
|---|---|
| Molecular weight | 226.29 g/mol |
| IUPAC name | 2,4-diamino-2-(1,1,2,2-tetradeuterio-2-sulfanylethyl)pentanedioic acid |
| InChIKey | MJMYLYUUBMQRFM-LNLMKGTHSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])S)C(CC(C(=O)O)N)(C(=O)O)N |
Computed by PubChem (NCBI)