CAS 1042646-00-3 is the registry number for 3-((3-Methyl-2,5-dioxoimidazolidin-1-yl)methyl)benzonitrile. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-[(3-methyl-2,5-dioxoimidazolidin-1-yl)methyl]benzonitrile (CAS 1042646-00-3) is a chemical compound with the molecular formula C12H11N3O2 and a molecular weight of 229.23 g/mol. IUPAC name: 3-[(3-methyl-2,5-dioxoimidazolidin-1-yl)methyl]benzonitrile. InChIKey: DGKBDWXUKNDHGK-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O2 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | 3-[(3-methyl-2,5-dioxoimidazolidin-1-yl)methyl]benzonitrile |
| InChIKey | DGKBDWXUKNDHGK-UHFFFAOYSA-N |
| SMILES | CN1CC(=O)N(C1=O)CC2=CC(=CC=C2)C#N |
Computed by PubChem (NCBI)