CAS 104272-77-7 appears in our catalog under these names: Benzenesulfonamide, 3-amino-4-phenoxy-, 95%, 3–amino–4–phenoxybenzenesulfonamide, 3-amino-4-phenoxybenzenesulfonamide, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 1g, 100mg, 250mg.
3-amino-4-phenoxybenzenesulfonamide (CAS 104272-77-7) is a chemical compound with the molecular formula C12H12N2O3S and a molecular weight of 264.30 g/mol. IUPAC name: 3-amino-4-phenoxybenzenesulfonamide. InChIKey: DDJNTNSYBPJURZ-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O3S |
|---|---|
| Molecular weight | 264.30 g/mol |
| IUPAC name | 3-amino-4-phenoxybenzenesulfonamide |
| InChIKey | DDJNTNSYBPJURZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=C(C=C(C=C2)S(=O)(=O)N)N |
Computed by PubChem (NCBI)