Products 1189749-81-2

CAS 1189749-81-2 is the registry number for 2-[(4-Methoxybenzyl)amino]-1,3-thiazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-[(4-methoxyphenyl)methylamino]-1,3-thiazole-4-carboxylic acid (CAS 1189749-81-2) is a chemical compound with the molecular formula C12H12N2O3S and a molecular weight of 264.30 g/mol. IUPAC name: 2-[(4-methoxyphenyl)methylamino]-1,3-thiazole-4-carboxylic acid. InChIKey: YYOSOVSWYIJUMR-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12N2O3S
Molecular weight264.30 g/mol
IUPAC name2-[(4-methoxyphenyl)methylamino]-1,3-thiazole-4-carboxylic acid
InChIKeyYYOSOVSWYIJUMR-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)CNC2=NC(=CS2)C(=O)O

Computed by PubChem (NCBI)