CAS 218631-55-1 is the registry number for Methyl 2-amino-4-(4-methoxyphenyl)thiazole-5-carboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 100g, 5g.
Methyl 2-amino-4-(4-methoxyphenyl)-1,3-thiazole-5-carboxylate (CAS 218631-55-1) is a chemical compound with the molecular formula C12H12N2O3S and a molecular weight of 264.30 g/mol. IUPAC name: methyl 2-amino-4-(4-methoxyphenyl)-1,3-thiazole-5-carboxylate. InChIKey: UBSRFDCUXNFFFV-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O3S |
|---|---|
| Molecular weight | 264.30 g/mol |
| IUPAC name | methyl 2-amino-4-(4-methoxyphenyl)-1,3-thiazole-5-carboxylate |
| InChIKey | UBSRFDCUXNFFFV-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(SC(=N2)N)C(=O)OC |
Computed by PubChem (NCBI)