CAS 851903-45-2 appears in our catalog under these names: 2-([(3,5-Dimethylisoxazol-4-yl)methyl]thio)nicotinic acid, 95%, 2-{((Dimethyl-1,2-oxazol-4-yl)methyl)sulfanyl}pyridine-3-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]pyridine-3-carboxylic acid (CAS 851903-45-2) is a chemical compound with the molecular formula C12H12N2O3S and a molecular weight of 264.30 g/mol. IUPAC name: 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]pyridine-3-carboxylic acid. InChIKey: NGIXNFYAERHBRC-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O3S |
|---|---|
| Molecular weight | 264.30 g/mol |
| IUPAC name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]pyridine-3-carboxylic acid |
| InChIKey | NGIXNFYAERHBRC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)CSC2=C(C=CC=N2)C(=O)O |
Computed by PubChem (NCBI)