CAS 438622-94-7 is the registry number for 5-(4,6-Dimethyl-pyrimidin-2-ylsulfanylmethyl)-furan-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]furan-2-carboxylic acid (CAS 438622-94-7) is a chemical compound with the molecular formula C12H12N2O3S and a molecular weight of 264.30 g/mol. IUPAC name: 5-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]furan-2-carboxylic acid. InChIKey: HWENPASLBBETFY-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O3S |
|---|---|
| Molecular weight | 264.30 g/mol |
| IUPAC name | 5-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]furan-2-carboxylic acid |
| InChIKey | HWENPASLBBETFY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)SCC2=CC=C(O2)C(=O)O)C |
Computed by PubChem (NCBI)