CAS 5624-27-1 appears in our catalog under these names: Phenylthiohydantoin-glutamic acid, 98%, Phenylthiohydantoin–glutamic Acid, Phenylthiohydantoin-glutamic Acid, ≥95%, ≥95%, 3-(5-Oxo-1-phenyl-2-thioxoimidazolidin-4-yl)propanoic acid, >95.0%(HPLC)(T). Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
3-(5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-yl)propanoic acid (CAS 5624-27-1) is a chemical compound with the molecular formula C12H12N2O3S and a molecular weight of 264.30 g/mol. IUPAC name: 3-(5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-yl)propanoic acid. InChIKey: ULKNJYDXLYMGFB-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O3S |
|---|---|
| Molecular weight | 264.30 g/mol |
| IUPAC name | 3-(5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-yl)propanoic acid |
| InChIKey | ULKNJYDXLYMGFB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)C(NC2=S)CCC(=O)O |
Computed by PubChem (NCBI)