Products 1044518-75-3
CAS 1044518-75-3 appears in our catalog under these names: Pitavastatin Impurity 8, Pitavastatin Impurity 2, tert-Butyl 2-((4S,6R)-6-formyl-2,2-dimethyl-1,3-dioxan-4-yl)acetate, 95%, Rosuvastatin Impurity 37, Amphotericin B Impurity 14. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
Tert-butyl 2-[(4S,6R)-6-formyl-2,2-dimethyl-1,3-dioxan-4-yl]acetate (CAS 1044518-75-3) is a chemical compound with the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. IUPAC name: tert-butyl 2-[(4S,6R)-6-formyl-2,2-dimethyl-1,3-dioxan-4-yl]acetate. InChIKey: JEFQIIXBSQLRTF-VHSXEESVSA-N.
| Molecular formula | C13H22O5 |
|---|---|
| Molecular weight | 258.31 g/mol |
| IUPAC name | tert-butyl 2-[(4S,6R)-6-formyl-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| InChIKey | JEFQIIXBSQLRTF-VHSXEESVSA-N |
| SMILES | CC1(O[C@@H](C[C@@H](O1)C=O)CC(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)