CAS 124752-23-4 appears in our catalog under these names: Rosuvastatin Impurity 52, tert-Butyl (4R-cis)-6-formaldehydel-2,2-dimethyl-1,3-dioxane-4-acetate 95%, tert-Butyl (4R-cis)-6-formaldehydel-2,2-dimethyl-1,3-dioxane-4-acetate, 98%, 98%, tert-Butyl [(4R,6S)-6-formyl-2,2-dimethyl-1,3-dioxan-4-yl]acetate (Standard), tert-Butyl (4R-cis)-6-formaldehydel-2,2-dimethyl-1,3-dioxane-4-acetate, 93%. Offered by: Chemat Brand, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: on request, 250mg, 1g, 10g, 25g, 100g, 500g, 5g.
Tert-butyl 2-[(4R,6S)-6-formyl-2,2-dimethyl-1,3-dioxan-4-yl]acetate (CAS 124752-23-4) is a chemical compound with the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. IUPAC name: tert-butyl 2-[(4R,6S)-6-formyl-2,2-dimethyl-1,3-dioxan-4-yl]acetate. InChIKey: JEFQIIXBSQLRTF-ZJUUUORDSA-N.
| Molecular formula | C13H22O5 |
|---|---|
| Molecular weight | 258.31 g/mol |
| IUPAC name | tert-butyl 2-[(4R,6S)-6-formyl-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| InChIKey | JEFQIIXBSQLRTF-ZJUUUORDSA-N |
| SMILES | CC1(O[C@H](C[C@H](O1)C=O)CC(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)