CAS 123185-87-5 appears in our catalog under these names: tert-Butyl 2-(rel-(4R,6S)-6-formyl-2,2-dimethyl-1,3-dioxan-4-yl)acetate, 95%, Tert–butyl 2–((4R,6S)–6–formyl–2,2–dimethyl–1,3–dioxan–4–yl)acetate. Offered by: AmBeed, GLPBio. Available pack sizes: 5g, 25g, 10g.
Tert-butyl 2-[(4R,6S)-6-formyl-2,2-dimethyl-1,3-dioxan-4-yl]acetate (CAS 123185-87-5) is a chemical compound with the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. IUPAC name: tert-butyl 2-[(4R,6S)-6-formyl-2,2-dimethyl-1,3-dioxan-4-yl]acetate. InChIKey: JEFQIIXBSQLRTF-ZJUUUORDSA-N.
| Molecular formula | C13H22O5 |
|---|---|
| Molecular weight | 258.31 g/mol |
| IUPAC name | tert-butyl 2-[(4R,6S)-6-formyl-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| InChIKey | JEFQIIXBSQLRTF-ZJUUUORDSA-N |
| SMILES | CC1(O[C@H](C[C@H](O1)C=O)CC(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)