Products 2787518-89-0

CAS 2787518-89-0 is the registry number for Rel-1-(tert-butyl) 1-methyl (1r,4r)-4-hydroxycyclohexane-1,1-dicarboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-O'-tert-butyl 1-O-methyl 4-hydroxycyclohexane-1,1-dicarboxylate (CAS 2787518-89-0) is a chemical compound with the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. IUPAC name: 1-O'-tert-butyl 1-O-methyl 4-hydroxycyclohexane-1,1-dicarboxylate. InChIKey: LGKMZQVTAIAOJR-UHFFFAOYSA-N.

Identity
Molecular formulaC13H22O5
Molecular weight258.31 g/mol
IUPAC name1-O'-tert-butyl 1-O-methyl 4-hydroxycyclohexane-1,1-dicarboxylate
InChIKeyLGKMZQVTAIAOJR-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)C1(CCC(CC1)O)C(=O)OC

Computed by PubChem (NCBI)