CAS 2124275-54-1 is the registry number for Pitavastatin Impurity 13. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2-[(4R,6R)-6-formyl-2,2-dimethyl-1,3-dioxan-4-yl]acetate (CAS 2124275-54-1) is a chemical compound with the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. IUPAC name: tert-butyl 2-[(4R,6R)-6-formyl-2,2-dimethyl-1,3-dioxan-4-yl]acetate. InChIKey: JEFQIIXBSQLRTF-NXEZZACHSA-N.
| Molecular formula | C13H22O5 |
|---|---|
| Molecular weight | 258.31 g/mol |
| IUPAC name | tert-butyl 2-[(4R,6R)-6-formyl-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| InChIKey | JEFQIIXBSQLRTF-NXEZZACHSA-N |
| SMILES | CC1(O[C@H](C[C@@H](O1)C=O)CC(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)