Products 2001608-38-2
CAS 2001608-38-2 is the registry number for diisopropyl 3-hydroxy-3-methyl-cyclobutane-1,1-dicarboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Dipropan-2-yl 3-hydroxy-3-methylcyclobutane-1,1-dicarboxylate (CAS 2001608-38-2) is a chemical compound with the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. IUPAC name: dipropan-2-yl 3-hydroxy-3-methylcyclobutane-1,1-dicarboxylate. InChIKey: UCVCPWOIQPJFQL-UHFFFAOYSA-N.
| Molecular formula | C13H22O5 |
|---|---|
| Molecular weight | 258.31 g/mol |
| IUPAC name | dipropan-2-yl 3-hydroxy-3-methylcyclobutane-1,1-dicarboxylate |
| InChIKey | UCVCPWOIQPJFQL-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1(CC(C1)(C)O)C(=O)OC(C)C |
Computed by PubChem (NCBI)