CAS 1044771-51-8 appears in our catalog under these names: 2-(tert-Butyl)-4,6-dichloropyrimidine, 98%, 2-tert-Butyl-4,6-dichloropyrimidine, 2-(Tert-Butyl)-4,6-Dichloropyrimidine, 97%, 97%, 2-(tert-Butyl)-4,6-dichloropyrimidine, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 100mg, 250mg, 25g, 2,5g, 1g, 500mg, 2.5g.
2-tert-butyl-4,6-dichloropyrimidine (CAS 1044771-51-8) is a chemical compound with the molecular formula C8H10Cl2N2 and a molecular weight of 205.08 g/mol. IUPAC name: 2-tert-butyl-4,6-dichloropyrimidine. InChIKey: INTDGBJUITUUCN-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl2N2 |
|---|---|
| Molecular weight | 205.08 g/mol |
| IUPAC name | 2-tert-butyl-4,6-dichloropyrimidine |
| InChIKey | INTDGBJUITUUCN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NC(=CC(=N1)Cl)Cl |
Computed by PubChem (NCBI)