Products 10465-70-0
CAS 10465-70-0 appears in our catalog under these names: (2E)-2-(4-Chlorophenyl)-3-phenyl-2-propenoic acid, 95%, 2-(4-Chlorophenyl)-3-phenylacrylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(Z)-2-(4-chlorophenyl)-3-phenylprop-2-enoic acid (CAS 10465-70-0) is a chemical compound with the molecular formula C15H11ClO2 and a molecular weight of 258.70 g/mol. IUPAC name: (Z)-2-(4-chlorophenyl)-3-phenylprop-2-enoic acid. InChIKey: VPXGAYMGNMHRTI-UVTDQMKNSA-N.
| Molecular formula | C15H11ClO2 |
|---|---|
| Molecular weight | 258.70 g/mol |
| IUPAC name | (Z)-2-(4-chlorophenyl)-3-phenylprop-2-enoic acid |
| InChIKey | VPXGAYMGNMHRTI-UVTDQMKNSA-N |
| SMILES | C1=CC=C(C=C1)/C=C(/C2=CC=C(C=C2)Cl)\C(=O)O |
Computed by PubChem (NCBI)