CAS 17059-59-5 appears in our catalog under these names: 1-(4-Chlorophenyl)-3-phenylpropane-1,3-dione, 98%, 1-(4-Chlorophenyl)-3-phenyl-1,3-propanedione, 95%, 95%, 1-(4-Chlorophenyl)-3-phenyl-1,3-propanedione, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
1-(4-chlorophenyl)-3-phenylpropane-1,3-dione (CAS 17059-59-5) is a chemical compound with the molecular formula C15H11ClO2 and a molecular weight of 258.70 g/mol. IUPAC name: 1-(4-chlorophenyl)-3-phenylpropane-1,3-dione. InChIKey: TYNRJXSHXIDFKH-UHFFFAOYSA-N.
| Molecular formula | C15H11ClO2 |
|---|---|
| Molecular weight | 258.70 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-3-phenylpropane-1,3-dione |
| InChIKey | TYNRJXSHXIDFKH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CC(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)