CAS 86508-29-4 appears in our catalog under these names: 1-(4-Chlorophenyl)-2-(4-methylphenyl)ethane-1,2-dione, 97%, 1-(4-Chlorophenyl)-2-(p-tolyl)ethane-1,2-dione, 97%. Offered by: Fluorochem, AmBeed. Available pack sizes: 1g, 5g.
1-(4-chlorophenyl)-2-(4-methylphenyl)ethane-1,2-dione (CAS 86508-29-4) is a chemical compound with the molecular formula C15H11ClO2 and a molecular weight of 258.70 g/mol. IUPAC name: 1-(4-chlorophenyl)-2-(4-methylphenyl)ethane-1,2-dione. InChIKey: FKOYORNUXJRIQT-UHFFFAOYSA-N.
| Molecular formula | C15H11ClO2 |
|---|---|
| Molecular weight | 258.70 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-2-(4-methylphenyl)ethane-1,2-dione |
| InChIKey | FKOYORNUXJRIQT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)