CAS 1096942-27-6 is the registry number for 5-(2-Chlorobenzoyl)-2,3-dihydro-1-benzofuran. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2-chlorophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methanone (CAS 1096942-27-6) is a chemical compound with the molecular formula C15H11ClO2 and a molecular weight of 258.70 g/mol. IUPAC name: (2-chlorophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methanone. InChIKey: ZBTHDCCAAGVUMR-UHFFFAOYSA-N.
| Molecular formula | C15H11ClO2 |
|---|---|
| Molecular weight | 258.70 g/mol |
| IUPAC name | (2-chlorophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methanone |
| InChIKey | ZBTHDCCAAGVUMR-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C=C(C=C2)C(=O)C3=CC=CC=C3Cl |
Computed by PubChem (NCBI)