Products 7466-99-1

CAS 7466-99-1 is the registry number for 4-Chloro-(α-phenyl)-cinnamic acid. Offered by: Biosynth. Available pack sizes: 5mg, 2mg, 10mg, 25mg.

Structural formula: {0} (CAS {1})

(E)-3-(4-chlorophenyl)-2-phenylprop-2-enoic acid (CAS 7466-99-1) is a chemical compound with the molecular formula C15H11ClO2 and a molecular weight of 258.70 g/mol. IUPAC name: (E)-3-(4-chlorophenyl)-2-phenylprop-2-enoic acid. InChIKey: VRWKAXRIXMCDDY-GXDHUFHOSA-N.

Identity
Molecular formulaC15H11ClO2
Molecular weight258.70 g/mol
IUPAC name(E)-3-(4-chlorophenyl)-2-phenylprop-2-enoic acid
InChIKeyVRWKAXRIXMCDDY-GXDHUFHOSA-N
SMILESC1=CC=C(C=C1)/C(=C\C2=CC=C(C=C2)Cl)/C(=O)O

Computed by PubChem (NCBI)