CAS 189765-85-3 is the registry number for 9-Fluorenylmethyl Chlorocarbonate-d11. Offered by: TRC. Available pack sizes: 100mg.
[dideuterio-(1,2,3,4,5,6,7,8,9-nonadeuteriofluoren-9-yl)methyl] carbonochloridate (CAS 189765-85-3) is a chemical compound with the molecular formula C15H11ClO2 and a molecular weight of 269.76 g/mol. IUPAC name: [dideuterio-(1,2,3,4,5,6,7,8,9-nonadeuteriofluoren-9-yl)methyl] carbonochloridate. InChIKey: IRXSLJNXXZKURP-DWYWYSLNSA-N.
| Molecular formula | C15H11ClO2 |
|---|---|
| Molecular weight | 269.76 g/mol |
| IUPAC name | [dideuterio-(1,2,3,4,5,6,7,8,9-nonadeuteriofluoren-9-yl)methyl] carbonochloridate |
| InChIKey | IRXSLJNXXZKURP-DWYWYSLNSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C3=C(C(=C(C(=C3C2([2H])C([2H])([2H])OC(=O)Cl)[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)