Products 1046758-86-4
CAS 1046758-86-4 is the registry number for 2,3,3'-Trifluoro-4,4'-dimethoxy-1,1'-biphenyl, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,3-difluoro-1-(3-fluoro-4-methoxyphenyl)-4-methoxybenzene (CAS 1046758-86-4) is a chemical compound with the molecular formula C14H11F3O2 and a molecular weight of 268.23 g/mol. IUPAC name: 2,3-difluoro-1-(3-fluoro-4-methoxyphenyl)-4-methoxybenzene. InChIKey: XUBYZYQNSPOIQE-UHFFFAOYSA-N.
| Molecular formula | C14H11F3O2 |
|---|---|
| Molecular weight | 268.23 g/mol |
| IUPAC name | 2,3-difluoro-1-(3-fluoro-4-methoxyphenyl)-4-methoxybenzene |
| InChIKey | XUBYZYQNSPOIQE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=C(C(=C(C=C2)OC)F)F)F |
Computed by PubChem (NCBI)