CAS 929289-41-8 appears in our catalog under these names: 3-{(3-(trifluoromethyl)phenyl)methoxy}phenol, 95%, 3-{(3-(Trifluoromethyl)phenyl)methoxy}phenol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-[[3-(trifluoromethyl)phenyl]methoxy]phenol (CAS 929289-41-8) is a chemical compound with the molecular formula C14H11F3O2 and a molecular weight of 268.23 g/mol. IUPAC name: 3-[[3-(trifluoromethyl)phenyl]methoxy]phenol. InChIKey: HWQRNZGCIDGVFW-UHFFFAOYSA-N.
| Molecular formula | C14H11F3O2 |
|---|---|
| Molecular weight | 268.23 g/mol |
| IUPAC name | 3-[[3-(trifluoromethyl)phenyl]methoxy]phenol |
| InChIKey | HWQRNZGCIDGVFW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)COC2=CC=CC(=C2)O |
Computed by PubChem (NCBI)