Products 1261464-05-4
CAS 1261464-05-4 appears in our catalog under these names: 3-Methyl-4'-(trifluoromethoxy)-[1,1'-biphenyl]-4-ol 95%, 4-Hydroxy-3-methyl-4'-(trifluoromethoxy)biphenyl, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-methyl-4-[4-(trifluoromethoxy)phenyl]phenol (CAS 1261464-05-4) is a chemical compound with the molecular formula C14H11F3O2 and a molecular weight of 268.23 g/mol. IUPAC name: 2-methyl-4-[4-(trifluoromethoxy)phenyl]phenol. InChIKey: QXSUPPBWSBMGAR-UHFFFAOYSA-N.
| Molecular formula | C14H11F3O2 |
|---|---|
| Molecular weight | 268.23 g/mol |
| IUPAC name | 2-methyl-4-[4-(trifluoromethoxy)phenyl]phenol |
| InChIKey | QXSUPPBWSBMGAR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=CC=C(C=C2)OC(F)(F)F)O |
Computed by PubChem (NCBI)