CAS 104741-23-3 is the registry number for 1-(4-Methoxy-3-nitrobenzenesulfonyl)piperidine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-(4-methoxy-3-nitrophenyl)sulfonylpiperidine (CAS 104741-23-3) is a chemical compound with the molecular formula C12H16N2O5S and a molecular weight of 300.33 g/mol. IUPAC name: 1-(4-methoxy-3-nitrophenyl)sulfonylpiperidine. InChIKey: KSNCXVFNNAPSDE-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O5S |
|---|---|
| Molecular weight | 300.33 g/mol |
| IUPAC name | 1-(4-methoxy-3-nitrophenyl)sulfonylpiperidine |
| InChIKey | KSNCXVFNNAPSDE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)S(=O)(=O)N2CCCCC2)[N+](=O)[O-] |
Computed by PubChem (NCBI)