Products 2270905-25-2
CAS 2270905-25-2 is the registry number for Methanesulfonic acid 1-(3-methyl-4-nitro-phenyl)-pyrrolidin-3-yl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
[1-(3-methyl-4-nitrophenyl)pyrrolidin-3-yl] methanesulfonate (CAS 2270905-25-2) is a chemical compound with the molecular formula C12H16N2O5S and a molecular weight of 300.33 g/mol. IUPAC name: [1-(3-methyl-4-nitrophenyl)pyrrolidin-3-yl] methanesulfonate. InChIKey: RDRZGSLHHBELFF-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O5S |
|---|---|
| Molecular weight | 300.33 g/mol |
| IUPAC name | [1-(3-methyl-4-nitrophenyl)pyrrolidin-3-yl] methanesulfonate |
| InChIKey | RDRZGSLHHBELFF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N2CCC(C2)OS(=O)(=O)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)