CAS 650584-47-7 is the registry number for 4-((4-(N,N-Dimethylsulfamoyl)phenyl)amino)-4-oxobutanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[4-(dimethylsulfamoyl)anilino]-4-oxobutanoic acid (CAS 650584-47-7) is a chemical compound with the molecular formula C12H16N2O5S and a molecular weight of 300.33 g/mol. IUPAC name: 4-[4-(dimethylsulfamoyl)anilino]-4-oxobutanoic acid. InChIKey: VAEZXBOKUMXNRO-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O5S |
|---|---|
| Molecular weight | 300.33 g/mol |
| IUPAC name | 4-[4-(dimethylsulfamoyl)anilino]-4-oxobutanoic acid |
| InChIKey | VAEZXBOKUMXNRO-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC=C(C=C1)NC(=O)CCC(=O)O |
Computed by PubChem (NCBI)