CAS 303977-18-6 appears in our catalog under these names: 1-(4-Nitrophenyl)piperidin-4-yl methanesulfonate, 95%, 1–(4–Nitrophenyl)piperidin–4–yl methanesulfonate, 1-(4-Nitrophenyl)piperidin-4-yl methanesulfonate, 95%, 95%, 1-(4-NITROPHENYL)PIPERIDIN-4-YL METHANESULFONATE, ≥95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 100mg, 250mg.
[1-(4-nitrophenyl)piperidin-4-yl] methanesulfonate (CAS 303977-18-6) is a chemical compound with the molecular formula C12H16N2O5S and a molecular weight of 300.33 g/mol. IUPAC name: [1-(4-nitrophenyl)piperidin-4-yl] methanesulfonate. InChIKey: XEXKLYWORMEHAP-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O5S |
|---|---|
| Molecular weight | 300.33 g/mol |
| IUPAC name | [1-(4-nitrophenyl)piperidin-4-yl] methanesulfonate |
| InChIKey | XEXKLYWORMEHAP-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OC1CCN(CC1)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)