Products 960009-35-2
CAS 960009-35-2 appears in our catalog under these names: Sildenafil Impurity 158, 2-Hydroxy-5-((4-methyl-1-piperazinyl)sulfonyl)benzoic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
2-hydroxy-5-(4-methylpiperazin-1-yl)sulfonylbenzoic acid (CAS 960009-35-2) is a chemical compound with the molecular formula C12H16N2O5S and a molecular weight of 300.33 g/mol. IUPAC name: 2-hydroxy-5-(4-methylpiperazin-1-yl)sulfonylbenzoic acid. InChIKey: VAROPFJZCJJKST-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O5S |
|---|---|
| Molecular weight | 300.33 g/mol |
| IUPAC name | 2-hydroxy-5-(4-methylpiperazin-1-yl)sulfonylbenzoic acid |
| InChIKey | VAROPFJZCJJKST-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)S(=O)(=O)C2=CC(=C(C=C2)O)C(=O)O |
Computed by PubChem (NCBI)