Products 781626-63-9
CAS 781626-63-9 appears in our catalog under these names: ((4-[(Isopropylamino)sulfonyl]benzoyl)amino)acetic acid, 95%, 2-({4-((propan-2-yl)sulfamoyl)phenyl}formamido)acetic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-[[4-(propan-2-ylsulfamoyl)benzoyl]amino]acetic acid (CAS 781626-63-9) is a chemical compound with the molecular formula C12H16N2O5S and a molecular weight of 300.33 g/mol. IUPAC name: 2-[[4-(propan-2-ylsulfamoyl)benzoyl]amino]acetic acid. InChIKey: UNDDMYFAGBTHLQ-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O5S |
|---|---|
| Molecular weight | 300.33 g/mol |
| IUPAC name | 2-[[4-(propan-2-ylsulfamoyl)benzoyl]amino]acetic acid |
| InChIKey | UNDDMYFAGBTHLQ-UHFFFAOYSA-N |
| SMILES | CC(C)NS(=O)(=O)C1=CC=C(C=C1)C(=O)NCC(=O)O |
Computed by PubChem (NCBI)