CAS 1047675-39-7 appears in our catalog under these names: 1-Azatricyclo(3.3.1.1,3,7)decane-4-carboxylic acid hydrochloride, 95%, 1-Azatricyclo(3.3.1.1,3,7)decane-4-carboxylic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-azatricyclo[3.3.1.13,7]decane-4-carboxylic acid;hydrochloride (CAS 1047675-39-7) is a chemical compound with the molecular formula C10H16ClNO2 and a molecular weight of 217.69 g/mol. IUPAC name: 1-azatricyclo[3.3.1.13,7]decane-4-carboxylic acid;hydrochloride. InChIKey: VTUVCQMJJGEFNC-UHFFFAOYSA-N.
| Molecular formula | C10H16ClNO2 |
|---|---|
| Molecular weight | 217.69 g/mol |
| IUPAC name | 1-azatricyclo[3.3.1.13,7]decane-4-carboxylic acid;hydrochloride |
| InChIKey | VTUVCQMJJGEFNC-UHFFFAOYSA-N |
| SMILES | C1C2CC3CN(C2)CC1C3C(=O)O.Cl |
Computed by PubChem (NCBI)