CAS 104786-99-4 is the registry number for N-Formyl Mesalazine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 2mg, 5mg.
5-formamido-2-hydroxybenzoic acid (CAS 104786-99-4) is a chemical compound with the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. IUPAC name: 5-formamido-2-hydroxybenzoic acid. InChIKey: QGAYHKZPLHBHSD-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 5-formamido-2-hydroxybenzoic acid |
| InChIKey | QGAYHKZPLHBHSD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NC=O)C(=O)O)O |
Computed by PubChem (NCBI)