CAS 1048371-03-4 appears in our catalog under these names: Upf 1069, 95%, UPF 1069, UPF 1069/ 98.84% (existing batch purity), 5-Phenacyloxy-2H-isoquinolin-1-one, UPF 1069 98%. Offered by: Combi-blocks, GLPBio, TargetMol, Biosynth, Ambeed. Available pack sizes: 100mg, 10mg, 10mM (in 1ml dmso), 50mg, 5mg, 25mg, 250mg, 5 mg.
5-phenacyloxy-2H-isoquinolin-1-one (CAS 1048371-03-4) is a chemical compound with the molecular formula C17H13NO3 and a molecular weight of 279.29 g/mol. IUPAC name: 5-phenacyloxy-2H-isoquinolin-1-one. InChIKey: JJWMRRNGWSITSQ-UHFFFAOYSA-N.
| Molecular formula | C17H13NO3 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | 5-phenacyloxy-2H-isoquinolin-1-one |
| InChIKey | JJWMRRNGWSITSQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)COC2=CC=CC3=C2C=CNC3=O |
Computed by PubChem (NCBI)