CAS 1049652-25-6 is the registry number for 3-Oxo-3,4-dihydro-2H-benzo(b)(1,4)oxazine-5-sulfonyl chloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
3-oxo-4H-1,4-benzoxazine-5-sulfonyl chloride (CAS 1049652-25-6) is a chemical compound with the molecular formula C8H6ClNO4S and a molecular weight of 247.66 g/mol. IUPAC name: 3-oxo-4H-1,4-benzoxazine-5-sulfonyl chloride. InChIKey: RWYAGUXUOGGNGN-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO4S |
|---|---|
| Molecular weight | 247.66 g/mol |
| IUPAC name | 3-oxo-4H-1,4-benzoxazine-5-sulfonyl chloride |
| InChIKey | RWYAGUXUOGGNGN-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C=CC=C2S(=O)(=O)Cl |
Computed by PubChem (NCBI)