CAS 868962-24-7 is the registry number for 2H-1,4-Benzoxazine-7-sulfonyl chloride, 3,4-dihydro-3-oxo-, 97%. Offered by: AmBeed. Available pack sizes: 1g.
3-oxo-4H-1,4-benzoxazine-7-sulfonyl chloride (CAS 868962-24-7) is a chemical compound with the molecular formula C8H6ClNO4S and a molecular weight of 247.66 g/mol. IUPAC name: 3-oxo-4H-1,4-benzoxazine-7-sulfonyl chloride. InChIKey: VKPIVQBWGKJCAB-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO4S |
|---|---|
| Molecular weight | 247.66 g/mol |
| IUPAC name | 3-oxo-4H-1,4-benzoxazine-7-sulfonyl chloride |
| InChIKey | VKPIVQBWGKJCAB-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)