Products 1785307-15-4

CAS 1785307-15-4 appears in our catalog under these names: 2-Oxo-2,4-dihydro-1H-3,1-benzoxazine-6-sulfonyl chloride, 95%, 95%, 2-OXO-2,4-DIHYDRO-1H-3,1-BENZOXAZINE-6-SULFONYL CHLORIDE, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

2-oxo-1,4-dihydro-3,1-benzoxazine-6-sulfonyl chloride (CAS 1785307-15-4) is a chemical compound with the molecular formula C8H6ClNO4S and a molecular weight of 247.66 g/mol. IUPAC name: 2-oxo-1,4-dihydro-3,1-benzoxazine-6-sulfonyl chloride. InChIKey: ZGFSCIJIFWGMBK-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6ClNO4S
Molecular weight247.66 g/mol
IUPAC name2-oxo-1,4-dihydro-3,1-benzoxazine-6-sulfonyl chloride
InChIKeyZGFSCIJIFWGMBK-UHFFFAOYSA-N
SMILESC1C2=C(C=CC(=C2)S(=O)(=O)Cl)NC(=O)O1

Computed by PubChem (NCBI)