CAS 1060817-75-5 appears in our catalog under these names: 5-(3-Methyl-5-isoxazolyl)-2-furansulfonyl chloride, 95%, 5-(3-Methylisoxazol-5-yl)furan-2-sulfonyl chloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
5-(3-methyl-1,2-oxazol-5-yl)furan-2-sulfonyl chloride (CAS 1060817-75-5) is a chemical compound with the molecular formula C8H6ClNO4S and a molecular weight of 247.66 g/mol. IUPAC name: 5-(3-methyl-1,2-oxazol-5-yl)furan-2-sulfonyl chloride. InChIKey: HAAGKUCFHFJVMM-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO4S |
|---|---|
| Molecular weight | 247.66 g/mol |
| IUPAC name | 5-(3-methyl-1,2-oxazol-5-yl)furan-2-sulfonyl chloride |
| InChIKey | HAAGKUCFHFJVMM-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=C1)C2=CC=C(O2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)