CAS 78633-42-8 appears in our catalog under these names: 3-Methyl-2-oxo-2,3-dihydro-1,3-benzoxazole-5-sulfonyl chloride, 95%, 3-Methyl-2-oxo-2,3-dihydrobenzo(d)oxazole-5-sulfonyl chloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
3-methyl-2-oxo-1,3-benzoxazole-5-sulfonyl chloride (CAS 78633-42-8) is a chemical compound with the molecular formula C8H6ClNO4S and a molecular weight of 247.66 g/mol. IUPAC name: 3-methyl-2-oxo-1,3-benzoxazole-5-sulfonyl chloride. InChIKey: VOVZUAYMQLWUCT-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO4S |
|---|---|
| Molecular weight | 247.66 g/mol |
| IUPAC name | 3-methyl-2-oxo-1,3-benzoxazole-5-sulfonyl chloride |
| InChIKey | VOVZUAYMQLWUCT-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=C2)S(=O)(=O)Cl)OC1=O |
Computed by PubChem (NCBI)