CAS 1427379-39-2 appears in our catalog under these names: 2-Oxo-3,4-dihydro-2H-1,3-benzoxazine-6-sulfonyl chloride, 95%, 2-Oxo-3,4-dihydro-2H-1,3-benzoxazine-6-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-oxo-3,4-dihydro-1,3-benzoxazine-6-sulfonyl chloride (CAS 1427379-39-2) is a chemical compound with the molecular formula C8H6ClNO4S and a molecular weight of 247.66 g/mol. IUPAC name: 2-oxo-3,4-dihydro-1,3-benzoxazine-6-sulfonyl chloride. InChIKey: BFJZXQYCVVUZGT-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO4S |
|---|---|
| Molecular weight | 247.66 g/mol |
| IUPAC name | 2-oxo-3,4-dihydro-1,3-benzoxazine-6-sulfonyl chloride |
| InChIKey | BFJZXQYCVVUZGT-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)S(=O)(=O)Cl)OC(=O)N1 |
Computed by PubChem (NCBI)